C16H21N3O — CID 91232887
6,11-dihydropyridazino[4,3-c][1]benzazepin-5-one;ethane (PubChem CID 91232887) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 6,11-dihydropyridazino[4,3-c][1]benzazepin-5-one;ethane.
| Compound Name | 6,11-dihydropyridazino[4,3-c][1]benzazepin-5-one;ethane |
|---|---|
| PubChem CID | 91232887 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 6,11-dihydropyridazino[4,3-c][1]benzazepin-5-one;ethane |
| SMILES | CC.CC.O=C1Nc2ccccc2Cc2nnccc21 |
| InChI | InChI=1S/C12H9N3O.2C2H6/c16-12-9-5-6-13-15-11(9)7-8-3-1-2-4-10(8)14-12;2*1-2/h1-6H,7H2,(H,14,16);2*1-2H3 |
| InChIKey | FZOPSBUXMANIKT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |