About N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide
N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide (PubChem CID 23439064) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide.
Molecular Properties
| Compound Name | N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide |
| PubChem CID | 23439064 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide |
| SMILES | Cc1cc2c(cc1NC=O)NC(=O)C2 |
| InChI | InChI=1S/C10H10N2O2/c1-6-2-7-3-10(14)12-9(7)4-8(6)11-5-13/h2,4-5H,3H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | RFYLKTMJPYKIDO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide?
The IUPAC name of N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide (CID 23439064) is N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide.
What is the SMILES notation for N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide?
The canonical SMILES for N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide is Cc1cc2c(cc1NC=O)NC(=O)C2.
What is the InChIKey of N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide?
The InChIKey is RFYLKTMJPYKIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-2-7-3-10(14)12-9(7)4-8(6)11-5-13/h2,4-5H,3H2,1H3,(H,11,13)(H,12,14).
What are the key properties of N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide?
N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide has a molecular weight of 190.20 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-2-oxo-1,3-dihydroindol-6-yl)formamide is sourced from PubChem (CID 23439064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).