C12H13Cl2NO5S — CID 43323433
2,4-dichloro-5-[2-oxo-2-(propan-2-ylamino)ethyl]sulfonylbenzoic acid (PubChem CID 43323433) has the molecular formula C12H13Cl2NO5S and a molecular weight of 354.21 g/mol. Its IUPAC name is 2,4-dichloro-5-[2-oxo-2-(propan-2-ylamino)ethyl]sulfonylbenzoic acid.
| Compound Name | 2,4-dichloro-5-[2-oxo-2-(propan-2-ylamino)ethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43323433 |
| Molecular Formula | C12H13Cl2NO5S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2,4-dichloro-5-[2-oxo-2-(propan-2-ylamino)ethyl]sulfonylbenzoic acid |
| SMILES | CC(C)NC(=O)CS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO5S/c1-6(2)15-11(16)5-21(19,20)10-3-7(12(17)18)8(13)4-9(10)14/h3-4,6H,5H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BXCCNSSBOVCHFJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |