C12H16F2N2OS — CID 113478500
3-amino-2,6-difluoro-N-(2-methyl-2-methylsulfanylpropyl)benzamide (PubChem CID 113478500) has the molecular formula C12H16F2N2OS and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-(2-methyl-2-methylsulfanylpropyl)benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-(2-methyl-2-methylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 113478500 |
| Molecular Formula | C12H16F2N2OS |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-amino-2,6-difluoro-N-(2-methyl-2-methylsulfanylpropyl)benzamide |
| SMILES | CSC(C)(C)CNC(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C12H16F2N2OS/c1-12(2,18-3)6-16-11(17)9-7(13)4-5-8(15)10(9)14/h4-5H,6,15H2,1-3H3,(H,16,17) |
| InChIKey | XZMPKNQZVAUTQD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|