C13H18F2N2O2 — CID 79772754
3-amino-2,6-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide (PubChem CID 79772754) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.29 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide |
|---|---|
| PubChem CID | 79772754 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-amino-2,6-difluoro-N-[3-(hydroxymethyl)pentan-3-yl]benzamide |
| SMILES | CCC(CC)(CO)NC(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C13H18F2N2O2/c1-3-13(4-2,7-18)17-12(19)10-8(14)5-6-9(16)11(10)15/h5-6,18H,3-4,7,16H2,1-2H3,(H,17,19) |
| InChIKey | VUSLJBARJKOQQM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|