C11H14N2O3S — CID 43164725
N-(cyclopropylmethyl)-2-sulfamoylbenzamide (PubChem CID 43164725) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-sulfamoylbenzamide.
| Compound Name | N-(cyclopropylmethyl)-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 43164725 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(cyclopropylmethyl)-2-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccccc1C(=O)NCC1CC1 |
| InChI | InChI=1S/C11H14N2O3S/c12-17(15,16)10-4-2-1-3-9(10)11(14)13-7-8-5-6-8/h1-4,8H,5-7H2,(H,13,14)(H2,12,15,16) |
| InChIKey | VAAAKYGJIBHMSG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |