C14H18N2O3S — CID 61480528
N-(dicyclopropylmethyl)-2-sulfamoylbenzamide (PubChem CID 61480528) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2-sulfamoylbenzamide.
| Compound Name | N-(dicyclopropylmethyl)-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 61480528 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(dicyclopropylmethyl)-2-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccccc1C(=O)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C14H18N2O3S/c15-20(18,19)12-4-2-1-3-11(12)14(17)16-13(9-5-6-9)10-7-8-10/h1-4,9-10,13H,5-8H2,(H,16,17)(H2,15,18,19) |
| InChIKey | XZJSEMOLACAVPX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |