C14H18ClFN2O3S — CID 134581318
5-chloro-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide (PubChem CID 134581318) has the molecular formula C14H18ClFN2O3S and a molecular weight of 348.83 g/mol. Its IUPAC name is 5-chloro-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide.
| Compound Name | 5-chloro-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 134581318 |
| Molecular Formula | C14H18ClFN2O3S |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 5-chloro-N'-cyclohexylsulfonyl-2-fluoro-3-methylbenzohydrazide |
| SMILES | Cc1cc(Cl)cc(C(=O)NNS(=O)(=O)C2CCCCC2)c1F |
| InChI | InChI=1S/C14H18ClFN2O3S/c1-9-7-10(15)8-12(13(9)16)14(19)17-18-22(20,21)11-5-3-2-4-6-11/h7-8,11,18H,2-6H2,1H3,(H,17,19) |
| InChIKey | DMQVKRJNKGLDDY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|