C16H21ClFNO4S — CID 167671598
N-[2-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide (PubChem CID 167671598) has the molecular formula C16H21ClFNO4S and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[2-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide.
| Compound Name | N-[2-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 167671598 |
| Molecular Formula | C16H21ClFNO4S |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[2-[3-chloro-2-fluoro-5-(methoxymethyl)phenyl]-2-oxoethyl]cyclohexanesulfonamide |
| SMILES | COCc1cc(Cl)c(F)c(C(=O)CNS(=O)(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C16H21ClFNO4S/c1-23-10-11-7-13(16(18)14(17)8-11)15(20)9-19-24(21,22)12-5-3-2-4-6-12/h7-8,12,19H,2-6,9-10H2,1H3 |
| InChIKey | WIZJXQPZUSFVQA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |