C18H21Cl2FN2O4S — CID 167573284
1-(cyclobutanecarbonyl)-N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]piperidine-4-sulfonamide (PubChem CID 167573284) has the molecular formula C18H21Cl2FN2O4S and a molecular weight of 451.35 g/mol. Its IUPAC name is 1-(cyclobutanecarbonyl)-N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]piperidine-4-sulfonamide.
| Compound Name | 1-(cyclobutanecarbonyl)-N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 167573284 |
| Molecular Formula | C18H21Cl2FN2O4S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 1-(cyclobutanecarbonyl)-N-[2-(3,5-dichloro-2-fluorophenyl)-2-oxoethyl]piperidine-4-sulfonamide |
| SMILES | O=C(CNS(=O)(=O)C1CCN(C(=O)C2CCC2)CC1)c1cc(Cl)cc(Cl)c1F |
| InChI | InChI=1S/C18H21Cl2FN2O4S/c19-12-8-14(17(21)15(20)9-12)16(24)10-22-28(26,27)13-4-6-23(7-5-13)18(25)11-2-1-3-11/h8-9,11,13,22H,1-7,10H2 |
| InChIKey | BHWDCSSVSWARKX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|