C22H28FN3O4S — CID 134581031
2-fluoro-N'-[[1-(2-hydroxyethyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide (PubChem CID 134581031) has the molecular formula C22H28FN3O4S and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-fluoro-N'-[[1-(2-hydroxyethyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide.
| Compound Name | 2-fluoro-N'-[[1-(2-hydroxyethyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide |
|---|---|
| PubChem CID | 134581031 |
| Molecular Formula | C22H28FN3O4S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-fluoro-N'-[[1-(2-hydroxyethyl)piperidin-4-yl]methylsulfonyl]-3-methyl-5-phenylbenzohydrazide |
| SMILES | Cc1cc(-c2ccccc2)cc(C(=O)NNS(=O)(=O)CC2CCN(CCO)CC2)c1F |
| InChI | InChI=1S/C22H28FN3O4S/c1-16-13-19(18-5-3-2-4-6-18)14-20(21(16)23)22(28)24-25-31(29,30)15-17-7-9-26(10-8-17)11-12-27/h2-6,13-14,17,25,27H,7-12,15H2,1H3,(H,24,28) |
| InChIKey | RIFCDDAWKWFYTI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|