C23H27F2N3O5S — CID 134581061
2-fluoro-5-(3-fluorophenyl)-N'-[[1-(2-methoxyacetyl)piperidin-3-yl]methylsulfonyl]-3-methylbenzohydrazide (PubChem CID 134581061) has the molecular formula C23H27F2N3O5S and a molecular weight of 495.55 g/mol. Its IUPAC name is 2-fluoro-5-(3-fluorophenyl)-N'-[[1-(2-methoxyacetyl)piperidin-3-yl]methylsulfonyl]-3-methylbenzohydrazide.
| Compound Name | 2-fluoro-5-(3-fluorophenyl)-N'-[[1-(2-methoxyacetyl)piperidin-3-yl]methylsulfonyl]-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 134581061 |
| Molecular Formula | C23H27F2N3O5S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-fluoro-5-(3-fluorophenyl)-N'-[[1-(2-methoxyacetyl)piperidin-3-yl]methylsulfonyl]-3-methylbenzohydrazide |
| SMILES | COCC(=O)N1CCCC(CS(=O)(=O)NNC(=O)c2cc(-c3cccc(F)c3)cc(C)c2F)C1 |
| InChI | InChI=1S/C23H27F2N3O5S/c1-15-9-18(17-6-3-7-19(24)10-17)11-20(22(15)25)23(30)26-27-34(31,32)14-16-5-4-8-28(12-16)21(29)13-33-2/h3,6-7,9-11,16,27H,4-5,8,12-14H2,1-2H3,(H,26,30) |
| InChIKey | AYESZSJIESOASB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|