C23H31F2N3O4S — CID 142366515
2-fluoro-5-(3-fluorophenyl)-3-methyl-N'-[(1-propanoylpiperidin-3-yl)methylsulfonyl]benzohydrazide;molecular hydrogen (PubChem CID 142366515) has the molecular formula C23H31F2N3O4S and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-fluoro-5-(3-fluorophenyl)-3-methyl-N'-[(1-propanoylpiperidin-3-yl)methylsulfonyl]benzohydrazide;molecular hydrogen.
| Compound Name | 2-fluoro-5-(3-fluorophenyl)-3-methyl-N'-[(1-propanoylpiperidin-3-yl)methylsulfonyl]benzohydrazide;molecular hydrogen |
|---|---|
| PubChem CID | 142366515 |
| Molecular Formula | C23H31F2N3O4S |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 2-fluoro-5-(3-fluorophenyl)-3-methyl-N'-[(1-propanoylpiperidin-3-yl)methylsulfonyl]benzohydrazide;molecular hydrogen |
| SMILES | CCC(=O)N1CCCC(CS(=O)(=O)NNC(=O)c2cc(-c3cccc(F)c3)cc(C)c2F)C1.[H][H].[H][H] |
| InChI | InChI=1S/C23H27F2N3O4S.2H2/c1-3-21(29)28-9-5-6-16(13-28)14-33(31,32)27-26-23(30)20-12-18(10-15(2)22(20)25)17-7-4-8-19(24)11-17;;/h4,7-8,10-12,16,27H,3,5-6,9,13-14H2,1-2H3,(H,26,30);2*1H |
| InChIKey | KUJMGSOXGZOUNN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|