C26H28FN3O2S — CID 142366434
2-fluoro-N'-[1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]sulfanyl-3-methyl-5-phenylbenzohydrazide (PubChem CID 142366434) has the molecular formula C26H28FN3O2S and a molecular weight of 465.59 g/mol. Its IUPAC name is 2-fluoro-N'-[1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]sulfanyl-3-methyl-5-phenylbenzohydrazide.
| Compound Name | 2-fluoro-N'-[1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]sulfanyl-3-methyl-5-phenylbenzohydrazide |
|---|---|
| PubChem CID | 142366434 |
| Molecular Formula | C26H28FN3O2S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-fluoro-N'-[1-[(3-methoxyphenyl)methyl]pyrrolidin-3-yl]sulfanyl-3-methyl-5-phenylbenzohydrazide |
| SMILES | COc1cccc(CN2CCC(SNNC(=O)c3cc(-c4ccccc4)cc(C)c3F)C2)c1 |
| InChI | InChI=1S/C26H28FN3O2S/c1-18-13-21(20-8-4-3-5-9-20)15-24(25(18)27)26(31)28-29-33-23-11-12-30(17-23)16-19-7-6-10-22(14-19)32-2/h3-10,13-15,23,29H,11-12,16-17H2,1-2H3,(H,28,31) |
| InChIKey | QXAIOZCCYKUWIZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|