C24H23ClFN3O3S — CID 134581329
N'-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]sulfonyl-2-fluoro-3-methyl-5-phenylbenzohydrazide (PubChem CID 134581329) has the molecular formula C24H23ClFN3O3S and a molecular weight of 487.98 g/mol. Its IUPAC name is N'-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]sulfonyl-2-fluoro-3-methyl-5-phenylbenzohydrazide.
| Compound Name | N'-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]sulfonyl-2-fluoro-3-methyl-5-phenylbenzohydrazide |
|---|---|
| PubChem CID | 134581329 |
| Molecular Formula | C24H23ClFN3O3S |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N'-[1-[(4-chlorophenyl)methyl]azetidin-3-yl]sulfonyl-2-fluoro-3-methyl-5-phenylbenzohydrazide |
| SMILES | Cc1cc(-c2ccccc2)cc(C(=O)NNS(=O)(=O)C2CN(Cc3ccc(Cl)cc3)C2)c1F |
| InChI | InChI=1S/C24H23ClFN3O3S/c1-16-11-19(18-5-3-2-4-6-18)12-22(23(16)26)24(30)27-28-33(31,32)21-14-29(15-21)13-17-7-9-20(25)10-8-17/h2-12,21,28H,13-15H2,1H3,(H,27,30) |
| InChIKey | GCVKSIOETYXLNO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|