C13H17ClFNO4S — CID 43570042
5-chloro-2-fluoro-3-[methyl(3-methylbutan-2-yl)sulfamoyl]benzoic acid (PubChem CID 43570042) has the molecular formula C13H17ClFNO4S and a molecular weight of 337.80 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-[methyl(3-methylbutan-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 5-chloro-2-fluoro-3-[methyl(3-methylbutan-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 43570042 |
| Molecular Formula | C13H17ClFNO4S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 5-chloro-2-fluoro-3-[methyl(3-methylbutan-2-yl)sulfamoyl]benzoic acid |
| SMILES | CC(C)C(C)N(C)S(=O)(=O)c1cc(Cl)cc(C(=O)O)c1F |
| InChI | InChI=1S/C13H17ClFNO4S/c1-7(2)8(3)16(4)21(19,20)11-6-9(14)5-10(12(11)15)13(17)18/h5-8H,1-4H3,(H,17,18) |
| InChIKey | JPKOVNXVYQUTOJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |