C16H13ClF4N2O4S — CID 86975272
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(difluoromethoxy)-2,6-difluorobenzamide (PubChem CID 86975272) has the molecular formula C16H13ClF4N2O4S and a molecular weight of 440.80 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(difluoromethoxy)-2,6-difluorobenzamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(difluoromethoxy)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 86975272 |
| Molecular Formula | C16H13ClF4N2O4S |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(difluoromethoxy)-2,6-difluorobenzamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1)c1c(F)cc(OC(F)F)cc1F |
| InChI | InChI=1S/C16H13ClF4N2O4S/c17-9-2-1-3-11(6-9)28(25,26)23-5-4-22-15(24)14-12(18)7-10(8-13(14)19)27-16(20)21/h1-3,6-8,16,23H,4-5H2,(H,22,24) |
| InChIKey | UHYBEGMMEKTMDI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|