C27H32N2O3 — CID 58730741
N-[2-(diethylamino)ethyl]-2-methoxy-4-[(4-phenoxyphenyl)methyl]benzamide (PubChem CID 58730741) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-methoxy-4-[(4-phenoxyphenyl)methyl]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-methoxy-4-[(4-phenoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58730741 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-methoxy-4-[(4-phenoxyphenyl)methyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(Cc2ccc(Oc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C27H32N2O3/c1-4-29(5-2)18-17-28-27(30)25-16-13-22(20-26(25)31-3)19-21-11-14-24(15-12-21)32-23-9-7-6-8-10-23/h6-16,20H,4-5,17-19H2,1-3H3,(H,28,30) |
| InChIKey | PJQGTEICBWVGBS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |