C29H32N4O3 — CID 90810207
N-[2-(diethylamino)ethyl]-2-methoxy-4-[5-(4-phenoxyphenyl)-1H-imidazol-2-yl]benzamide (PubChem CID 90810207) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-methoxy-4-[5-(4-phenoxyphenyl)-1H-imidazol-2-yl]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-methoxy-4-[5-(4-phenoxyphenyl)-1H-imidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 90810207 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-methoxy-4-[5-(4-phenoxyphenyl)-1H-imidazol-2-yl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(-c2ncc(-c3ccc(Oc4ccccc4)cc3)[nH]2)cc1OC |
| InChI | InChI=1S/C29H32N4O3/c1-4-33(5-2)18-17-30-29(34)25-16-13-22(19-27(25)35-3)28-31-20-26(32-28)21-11-14-24(15-12-21)36-23-9-7-6-8-10-23/h6-16,19-20H,4-5,17-18H2,1-3H3,(H,30,34)(H,31,32) |
| InChIKey | GSLUNBHUHKUBFN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |