C21H28ClN5O3 — CID 87941220
2-amino-3-chloro-N-[2-(diethylamino)ethyl]-6-methoxy-4-(phenylcarbamoylamino)benzamide (PubChem CID 87941220) has the molecular formula C21H28ClN5O3 and a molecular weight of 433.94 g/mol. Its IUPAC name is 2-amino-3-chloro-N-[2-(diethylamino)ethyl]-6-methoxy-4-(phenylcarbamoylamino)benzamide.
| Compound Name | 2-amino-3-chloro-N-[2-(diethylamino)ethyl]-6-methoxy-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 87941220 |
| Molecular Formula | C21H28ClN5O3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-amino-3-chloro-N-[2-(diethylamino)ethyl]-6-methoxy-4-(phenylcarbamoylamino)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1c(OC)cc(NC(=O)Nc2ccccc2)c(Cl)c1N |
| InChI | InChI=1S/C21H28ClN5O3/c1-4-27(5-2)12-11-24-20(28)17-16(30-3)13-15(18(22)19(17)23)26-21(29)25-14-9-7-6-8-10-14/h6-10,13H,4-5,11-12,23H2,1-3H3,(H,24,28)(H2,25,26,29) |
| InChIKey | WFIIWFQKQZLUEE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|