C22H28Cl2N4O2 — CID 42747665
3,4-dichloro-N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]benzamide (PubChem CID 42747665) has the molecular formula C22H28Cl2N4O2 and a molecular weight of 451.40 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 42747665 |
| Molecular Formula | C22H28Cl2N4O2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)c2ccc(Cl)c(Cl)c2)ccc1N(C)C |
| InChI | InChI=1S/C22H28Cl2N4O2/c1-5-28(6-2)12-11-25-22(30)17-14-16(8-10-20(17)27(3)4)26-21(29)15-7-9-18(23)19(24)13-15/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,25,30)(H,26,29) |
| InChIKey | HEEYNZHSDDXTLR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|