C23H31N5O4 — CID 42747675
N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 42747675) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42747675 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[3-[2-(diethylamino)ethylcarbamoyl]-4-(dimethylamino)phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)c2ccc(C)c([N+](=O)[O-])c2)ccc1N(C)C |
| InChI | InChI=1S/C23H31N5O4/c1-6-27(7-2)13-12-24-23(30)19-15-18(10-11-20(19)26(4)5)25-22(29)17-9-8-16(3)21(14-17)28(31)32/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,24,30)(H,25,29) |
| InChIKey | NYTCRFQEQKRQTQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|