C25H26N4O4 — CID 3948039
N-[4-(dimethylamino)-3-(1-phenylethylcarbamoyl)phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 3948039) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-(1-phenylethylcarbamoyl)phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-(dimethylamino)-3-(1-phenylethylcarbamoyl)phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3948039 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[4-(dimethylamino)-3-(1-phenylethylcarbamoyl)phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N(C)C)c(C(=O)NC(C)c3ccccc3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H26N4O4/c1-16-10-11-19(14-23(16)29(32)33)24(30)27-20-12-13-22(28(3)4)21(15-20)25(31)26-17(2)18-8-6-5-7-9-18/h5-15,17H,1-4H3,(H,26,31)(H,27,30) |
| InChIKey | GEKPTDNIUOSXBP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|