C25H28N4O2 — CID 7230440
2-(dimethylamino)-5-[(3-methylphenyl)carbamoylamino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 7230440) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[(3-methylphenyl)carbamoylamino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-(dimethylamino)-5-[(3-methylphenyl)carbamoylamino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 7230440 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-(dimethylamino)-5-[(3-methylphenyl)carbamoylamino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(N(C)C)c(C(=O)N[C@@H](C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H28N4O2/c1-17-9-8-12-20(15-17)27-25(31)28-21-13-14-23(29(3)4)22(16-21)24(30)26-18(2)19-10-6-5-7-11-19/h5-16,18H,1-4H3,(H,26,30)(H2,27,28,31)/t18-/m0/s1 |
| InChIKey | PDQRDPCSJAFYCU-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|