C26H26N4O4 — CID 42755956
2-(dimethylamino)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 42755956) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 2-(dimethylamino)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42755956 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-(dimethylamino)-5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)ccc1N(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H26N4O4/c1-18(20-7-5-4-6-8-20)27-26(32)23-17-21(12-15-24(23)29(2)3)28-25(31)16-11-19-9-13-22(14-10-19)30(33)34/h4-18H,1-3H3,(H,27,32)(H,28,31)/b16-11+ |
| InChIKey | WQGPTGBCKJCONG-LFIBNONCSA-N |
| XLogP | 4.80 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|