C26H29N3O4 — CID 42747404
5-[(3,5-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide (PubChem CID 42747404) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 5-[(3,5-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide.
| Compound Name | 5-[(3,5-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42747404 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 5-[(3,5-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N(C)C)c(C(=O)NC(C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-17(18-9-7-6-8-10-18)27-26(31)23-15-20(11-12-24(23)29(2)3)28-25(30)19-13-21(32-4)16-22(14-19)33-5/h6-17H,1-5H3,(H,27,31)(H,28,30) |
| InChIKey | HGNNIIDOGUSGGB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|