C24H24Cl2N4O2 — CID 4038266
5-[(2,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide (PubChem CID 4038266) has the molecular formula C24H24Cl2N4O2 and a molecular weight of 471.39 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide.
| Compound Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4038266 |
| Molecular Formula | C24H24Cl2N4O2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(NC(=O)Nc2ccc(Cl)cc2Cl)ccc1N(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H24Cl2N4O2/c1-15(16-7-5-4-6-8-16)27-23(31)19-14-18(10-12-22(19)30(2)3)28-24(32)29-21-11-9-17(25)13-20(21)26/h4-15H,1-3H3,(H,27,31)(H2,28,29,32) |
| InChIKey | SQYQCRBGSZSIBI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|