C21H24Cl2N4O2 — CID 1064102
5-[(2,4-dichlorophenyl)carbamoylamino]-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide (PubChem CID 1064102) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)carbamoylamino]-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1064102 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cc(NC(=O)Nc2ccc(Cl)cc2Cl)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H24Cl2N4O2/c1-13(2)24-20(28)16-12-15(6-8-19(16)27-9-3-4-10-27)25-21(29)26-18-7-5-14(22)11-17(18)23/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,24,28)(H2,25,26,29) |
| InChIKey | XJOQGLNZOYWAHV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|