C23H28Cl2N4O2 — CID 42751563
5-[(2,4-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-propan-2-ylbenzamide (PubChem CID 42751563) has the molecular formula C23H28Cl2N4O2 and a molecular weight of 463.41 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-propan-2-ylbenzamide.
| Compound Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 42751563 |
| Molecular Formula | C23H28Cl2N4O2 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-propan-2-ylbenzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)Nc3ccc(Cl)cc3Cl)cc2C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C23H28Cl2N4O2/c1-14(2)26-22(30)18-13-17(5-7-21(18)29-10-8-15(3)9-11-29)27-23(31)28-20-6-4-16(24)12-19(20)25/h4-7,12-15H,8-11H2,1-3H3,(H,26,30)(H2,27,28,31) |
| InChIKey | QTASCNLWVZWVBM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|