C28H29Cl2N5O3 — CID 42757365
N-cyclopropyl-5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42757365) has the molecular formula C28H29Cl2N5O3 and a molecular weight of 554.48 g/mol. Its IUPAC name is N-cyclopropyl-5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-cyclopropyl-5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42757365 |
| Molecular Formula | C28H29Cl2N5O3 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | N-cyclopropyl-5-[(2,4-dichlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccc(Cl)cc3Cl)cc2C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C28H29Cl2N5O3/c1-38-26-5-3-2-4-25(26)35-14-12-34(13-15-35)24-11-9-20(17-21(24)27(36)31-19-7-8-19)32-28(37)33-23-10-6-18(29)16-22(23)30/h2-6,9-11,16-17,19H,7-8,12-15H2,1H3,(H,31,36)(H2,32,33,37) |
| InChIKey | CUWWTRMBJOZGSK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|