C17H17NO3 — CID 81369000
2-[[(1R)-1-(3-methylphenyl)ethyl]carbamoyl]benzoic acid (PubChem CID 81369000) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[[(1R)-1-(3-methylphenyl)ethyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[(1R)-1-(3-methylphenyl)ethyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 81369000 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[[(1R)-1-(3-methylphenyl)ethyl]carbamoyl]benzoic acid |
| SMILES | Cc1cccc([C@@H](C)NC(=O)c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C17H17NO3/c1-11-6-5-7-13(10-11)12(2)18-16(19)14-8-3-4-9-15(14)17(20)21/h3-10,12H,1-2H3,(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | VWBVPKJUKKMESH-GFCCVEGCSA-N |
| XLogP | 3.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |