C24H31Cl2N5O2 — CID 42660921
5-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 42660921) has the molecular formula C24H31Cl2N5O2 and a molecular weight of 492.45 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42660921 |
| Molecular Formula | C24H31Cl2N5O2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)Nc2ccc(Cl)c(Cl)c2)ccc1N1CCCC1 |
| InChI | InChI=1S/C24H31Cl2N5O2/c1-3-30(4-2)14-11-27-23(32)19-15-17(8-10-22(19)31-12-5-6-13-31)28-24(33)29-18-7-9-20(25)21(26)16-18/h7-10,15-16H,3-6,11-14H2,1-2H3,(H,27,32)(H2,28,29,33) |
| InChIKey | URODEGRWHQOHGY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|