C26H35Cl2N5O2 — CID 42757410
5-[(2,6-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 42757410) has the molecular formula C26H35Cl2N5O2 and a molecular weight of 520.51 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[(2,6-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 42757410 |
| Molecular Formula | C26H35Cl2N5O2 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)carbamoylamino]-N-[2-(diethylamino)ethyl]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)Nc2c(Cl)cccc2Cl)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C26H35Cl2N5O2/c1-4-32(5-2)16-13-29-25(34)20-17-19(9-10-23(20)33-14-11-18(3)12-15-33)30-26(35)31-24-21(27)7-6-8-22(24)28/h6-10,17-18H,4-5,11-16H2,1-3H3,(H,29,34)(H2,30,31,35) |
| InChIKey | QGVLIKIVGCQSRG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|