C27H37FN4O2 — CID 42757259
N-[2-(diethylamino)ethyl]-5-[[2-(4-fluorophenyl)acetyl]amino]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 42757259) has the molecular formula C27H37FN4O2 and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-[[2-(4-fluorophenyl)acetyl]amino]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-[[2-(4-fluorophenyl)acetyl]amino]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 42757259 |
| Molecular Formula | C27H37FN4O2 |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-[[2-(4-fluorophenyl)acetyl]amino]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)Cc2ccc(F)cc2)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C27H37FN4O2/c1-4-31(5-2)17-14-29-27(34)24-19-23(10-11-25(24)32-15-12-20(3)13-16-32)30-26(33)18-21-6-8-22(28)9-7-21/h6-11,19-20H,4-5,12-18H2,1-3H3,(H,29,34)(H,30,33) |
| InChIKey | BCTWAAWMGAPOGB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|