C24H40N4O2 — CID 4538451
N-[2-(diethylamino)ethyl]-5-(3,3-dimethylbutanoylamino)-2-piperidin-1-ylbenzamide (PubChem CID 4538451) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-(3,3-dimethylbutanoylamino)-2-piperidin-1-ylbenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-(3,3-dimethylbutanoylamino)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4538451 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-(3,3-dimethylbutanoylamino)-2-piperidin-1-ylbenzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)CC(C)(C)C)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H40N4O2/c1-6-27(7-2)16-13-25-23(30)20-17-19(26-22(29)18-24(3,4)5)11-12-21(20)28-14-9-8-10-15-28/h11-12,17H,6-10,13-16,18H2,1-5H3,(H,25,30)(H,26,29) |
| InChIKey | CTZSDIXYAGNFQJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|