C25H31N3O2 — CID 5040811
5-[(2-phenylcyclopropanecarbonyl)amino]-2-piperidin-1-yl-N-propylbenzamide (PubChem CID 5040811) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 5-[(2-phenylcyclopropanecarbonyl)amino]-2-piperidin-1-yl-N-propylbenzamide.
| Compound Name | 5-[(2-phenylcyclopropanecarbonyl)amino]-2-piperidin-1-yl-N-propylbenzamide |
|---|---|
| PubChem CID | 5040811 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 5-[(2-phenylcyclopropanecarbonyl)amino]-2-piperidin-1-yl-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)C2CC2c2ccccc2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C25H31N3O2/c1-2-13-26-24(29)22-16-19(11-12-23(22)28-14-7-4-8-15-28)27-25(30)21-17-20(21)18-9-5-3-6-10-18/h3,5-6,9-12,16,20-21H,2,4,7-8,13-15,17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | OBGCHADGFXBJFK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|