C35H35FN4O3 — CID 3978424
N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylcyclopropanecarbonyl)amino]benzamide (PubChem CID 3978424) has the molecular formula C35H35FN4O3 and a molecular weight of 578.69 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylcyclopropanecarbonyl)amino]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylcyclopropanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 3978424 |
| Molecular Formula | C35H35FN4O3 |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylcyclopropanecarbonyl)amino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)C3CC3c3ccccc3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C35H35FN4O3/c1-43-33-10-6-5-9-32(33)40-19-17-39(18-20-40)31-16-15-27(38-35(42)29-22-28(29)25-7-3-2-4-8-25)21-30(31)34(41)37-23-24-11-13-26(36)14-12-24/h2-16,21,28-29H,17-20,22-23H2,1H3,(H,37,41)(H,38,42) |
| InChIKey | IXYWURUYGVTJFY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|