C32H33N3O2 — CID 4621165
N-[4-(4-methylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]naphthalene-1-carboxamide (PubChem CID 4621165) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 4621165 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]naphthalene-1-carboxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3cccc4ccccc34)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H33N3O2/c1-23-17-20-35(21-18-23)30-15-14-26(22-29(30)31(36)33-19-16-24-8-3-2-4-9-24)34-32(37)28-13-7-11-25-10-5-6-12-27(25)28/h2-15,22-23H,16-21H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | ZDVQOQWZCMWPSI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|