C32H33N3O2 — CID 93098297
N-[4-(4-methylpiperidin-1-yl)-3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-1-carboxamide (PubChem CID 93098297) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)-3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)-3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 93098297 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)-3-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-1-carboxamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3cccc4ccccc34)cc2C(=O)N[C@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H33N3O2/c1-22-17-19-35(20-18-22)30-16-15-26(21-29(30)32(37)33-23(2)24-9-4-3-5-10-24)34-31(36)28-14-8-12-25-11-6-7-13-27(25)28/h3-16,21-23H,17-20H2,1-2H3,(H,33,37)(H,34,36)/t23-/m1/s1 |
| InChIKey | QHXAZNQNVHWAAC-HSZRJFAPSA-N |
| XLogP | 6.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|