C23H27Cl2N3O2 — CID 4299183
5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide (PubChem CID 4299183) has the molecular formula C23H27Cl2N3O2 and a molecular weight of 448.39 g/mol. Its IUPAC name is 5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide.
| Compound Name | 5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4299183 |
| Molecular Formula | C23H27Cl2N3O2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 5-[(2,2-dichloroacetyl)amino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)C(Cl)Cl)cc2C(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27Cl2N3O2/c1-15-10-12-28(13-11-15)20-9-8-18(27-23(30)21(24)25)14-19(20)22(29)26-16(2)17-6-4-3-5-7-17/h3-9,14-16,21H,10-13H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | OVNSRUFKPDJIAF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|