C38H42N4O2 — CID 4239888
2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2,2-diphenylacetyl)amino]benzamide (PubChem CID 4239888) has the molecular formula C38H42N4O2 and a molecular weight of 586.78 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2,2-diphenylacetyl)amino]benzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2,2-diphenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 4239888 |
| Molecular Formula | C38H42N4O2 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2,2-diphenylacetyl)amino]benzamide |
| SMILES | O=C(NC1CCCCC1)c1cc(NC(=O)C(c2ccccc2)c2ccccc2)ccc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C38H42N4O2/c43-37(39-32-19-11-4-12-20-32)34-27-33(40-38(44)36(30-15-7-2-8-16-30)31-17-9-3-10-18-31)21-22-35(34)42-25-23-41(24-26-42)28-29-13-5-1-6-14-29/h1-3,5-10,13-18,21-22,27,32,36H,4,11-12,19-20,23-26,28H2,(H,39,43)(H,40,44) |
| InChIKey | DKKHCNMWJXLNJJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|