C33H40N4O3 — CID 1064521
2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2-phenylmethoxyacetyl)amino]benzamide (PubChem CID 1064521) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2-phenylmethoxyacetyl)amino]benzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2-phenylmethoxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 1064521 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[(2-phenylmethoxyacetyl)amino]benzamide |
| SMILES | O=C(COCc1ccccc1)Nc1ccc(N2CCN(Cc3ccccc3)CC2)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C33H40N4O3/c38-32(25-40-24-27-12-6-2-7-13-27)34-29-16-17-31(30(22-29)33(39)35-28-14-8-3-9-15-28)37-20-18-36(19-21-37)23-26-10-4-1-5-11-26/h1-2,4-7,10-13,16-17,22,28H,3,8-9,14-15,18-21,23-25H2,(H,34,38)(H,35,39) |
| InChIKey | MZUSGLGWWVDZSS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|