C24H21Cl3N4O3 — CID 5188080
2-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrobenzamide (PubChem CID 5188080) has the molecular formula C24H21Cl3N4O3 and a molecular weight of 519.82 g/mol. Its IUPAC name is 2-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 5188080 |
| Molecular Formula | C24H21Cl3N4O3 |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 2-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C24H21Cl3N4O3/c25-20-4-2-1-3-16(20)15-29-9-11-30(12-10-29)23-8-5-17(13-22(23)27)28-24(32)19-14-18(31(33)34)6-7-21(19)26/h1-8,13-14H,9-12,15H2,(H,28,32) |
| InChIKey | WSJIGGJWHRFWFJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|