C18H18ClN3O4 — CID 3495180
2-chloro-N-[4-(morpholin-4-ylmethyl)phenyl]-5-nitrobenzamide (PubChem CID 3495180) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 2-chloro-N-[4-(morpholin-4-ylmethyl)phenyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-(morpholin-4-ylmethyl)phenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 3495180 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-chloro-N-[4-(morpholin-4-ylmethyl)phenyl]-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc(CN2CCOCC2)cc1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O4/c19-17-6-5-15(22(24)25)11-16(17)18(23)20-14-3-1-13(2-4-14)12-21-7-9-26-10-8-21/h1-6,11H,7-10,12H2,(H,20,23) |
| InChIKey | YOVHFMZJONFOMY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|