C22H20Cl2N4O4 — CID 4273182
N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrofuran-2-carboxamide (PubChem CID 4273182) has the molecular formula C22H20Cl2N4O4 and a molecular weight of 475.33 g/mol. Its IUPAC name is N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 4273182 |
| Molecular Formula | C22H20Cl2N4O4 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C22H20Cl2N4O4/c23-17-4-2-1-3-15(17)14-26-9-11-27(12-10-26)19-6-5-16(13-18(19)24)25-22(29)20-7-8-21(32-20)28(30)31/h1-8,13H,9-12,14H2,(H,25,29) |
| InChIKey | WDTLOOVGKRWTEF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|