C31H33ClN4O5 — CID 42757263
2-(4-benzylpiperidin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 42757263) has the molecular formula C31H33ClN4O5 and a molecular weight of 577.08 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42757263 |
| Molecular Formula | C31H33ClN4O5 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCC2CCCO2)c1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C31H33ClN4O5/c32-28-19-24(36(39)40)9-10-26(28)31(38)34-23-8-11-29(27(18-23)30(37)33-20-25-7-4-16-41-25)35-14-12-22(13-15-35)17-21-5-2-1-3-6-21/h1-3,5-6,8-11,18-19,22,25H,4,7,12-17,20H2,(H,33,37)(H,34,38) |
| InChIKey | BYPCCMQNCDLMCT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|