C30H34N4O3 — CID 3428509
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3428509) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3428509 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(N3CCc4ccccc4C3)c(C(=O)NCC3CCCO3)c2)c1C |
| InChI | InChI=1S/C30H34N4O3/c1-20-7-5-11-27(21(20)2)33-30(36)32-24-12-13-28(34-15-14-22-8-3-4-9-23(22)19-34)26(17-24)29(35)31-18-25-10-6-16-37-25/h3-5,7-9,11-13,17,25H,6,10,14-16,18-19H2,1-2H3,(H,31,35)(H2,32,33,36) |
| InChIKey | VXGYUCGDGVRIGQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|