C29H31N3O4 — CID 3894665
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3894665) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3894665 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C29H31N3O4/c1-35-27-11-5-4-10-24(27)29(34)31-22-12-13-26(32-15-14-20-7-2-3-8-21(20)19-32)25(17-22)28(33)30-18-23-9-6-16-36-23/h2-5,7-8,10-13,17,23H,6,9,14-16,18-19H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | XQTQOVABVVHBQQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|