C32H29F3N4O2 — CID 3928925
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 3928925) has the molecular formula C32H29F3N4O2 and a molecular weight of 558.60 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 3928925 |
| Molecular Formula | C32H29F3N4O2 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C32H29F3N4O2/c33-32(34,35)25-11-6-12-26(19-25)37-31(41)38-27-13-14-29(39-18-16-23-9-4-5-10-24(23)21-39)28(20-27)30(40)36-17-15-22-7-2-1-3-8-22/h1-14,19-20H,15-18,21H2,(H,36,40)(H2,37,38,41) |
| InChIKey | YJFMGSKXAGHCCD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|