C31H29ClN4O2 — CID 42757351
5-[(3-chlorophenyl)carbamoylamino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide (PubChem CID 42757351) has the molecular formula C31H29ClN4O2 and a molecular weight of 525.05 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)carbamoylamino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(3-chlorophenyl)carbamoylamino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42757351 |
| Molecular Formula | C31H29ClN4O2 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 5-[(3-chlorophenyl)carbamoylamino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C31H29ClN4O2/c32-25-11-6-12-26(19-25)34-31(38)35-27-13-14-29(36-18-16-23-9-4-5-10-24(23)21-36)28(20-27)30(37)33-17-15-22-7-2-1-3-8-22/h1-14,19-20H,15-18,21H2,(H,33,37)(H2,34,35,38) |
| InChIKey | SBKDYBUFWRJASX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|